CAS 890095-58-6
:Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-(4-methyl-1,2,5-oxadiazol-3-yl)-, ethyl ester
Description:
Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-(4-methyl-1,2,5-oxadiazol-3-yl)-, ethyl ester is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core and an oxadiazole substituent. This compound typically exhibits properties associated with both heterocycles, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the carboxylic acid and ester functional groups suggests it may engage in esterification and hydrolysis reactions. Additionally, the oxadiazole moiety can contribute to the compound's electronic properties, potentially enhancing its reactivity or biological activity. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory, antimicrobial, or anticancer activities. The specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry and drug development.
Formula:C12H11N5O3
InChI:InChI=1S/C12H11N5O3/c1-3-19-12(18)8-6-14-17-9(4-5-13-11(8)17)10-7(2)15-20-16-10/h4-6H,3H2,1-2H3
InChI key:InChIKey=RIDIEJHAFBNYAI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(C(=CC=N2)C=3C(C)=NON3)N=C1
Synonyms:- Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-(4-methyl-1,2,5-oxadiazol-3-yl)-, ethyl ester
- Ethyl 7-(4-methyl-1,2,5-oxadiazol-3-yl)pyrazolo[1,5-a]pyrimidine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.