CAS 890095-75-7

Methyl 5-amino-4-thiocyanato-2-thiophenecarboxylate

Description:

Methyl 5-amino-4-thiocyanato-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring, an amino group, and a thiocyanate functional group. This compound typically exhibits properties associated with both thiophene derivatives and thiocyanates, such as potential biological activity and reactivity due to the presence of the amino and thiocyanate groups. The thiophene ring contributes to its aromatic character, which can influence its solubility and stability in various solvents. Methyl esters, like the one in this compound, often display moderate polarity, affecting their interactions in chemical reactions. The presence of the amino group may impart basicity, allowing for potential interactions with acids or electrophiles. Additionally, the thiocyanate group can participate in nucleophilic substitution reactions, making this compound of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Overall, Methyl 5-amino-4-thiocyanato-2-thiophenecarboxylate is a versatile compound with properties that can be exploited in various chemical and biological contexts.

Formula: C₇H₆N₂O₂S₂

InChI: InChI=1S/C7H6N2O2S2/c1-11-7(10)5-2-4(12-3-8)6(9)13-5/h2H,9H2,1H3

InChI key: InChIKey=ULLPSNBPFYVPDS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(SC#N)=C(N)S1

Synonyms:

• 2-Thiophenecarboxylic acid, 5-amino-4-thiocyanato-, methyl ester
• Methyl 5-amino-4-thiocyanato-2-thiophenecarboxylate