CAS 890097-68-4
:(2-but-3-enylphenyl) acetate
Description:
(2-but-3-enylphenyl) acetate is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a but-3-enyl group attached to a phenyl ring, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the double bond in the but-3-enyl moiety introduces unsaturation, which can participate in various chemical reactions, such as polymerization or addition reactions. The acetate group enhances the compound's solubility in organic solvents and may influence its volatility and stability. Typically, compounds like (2-but-3-enylphenyl) acetate are utilized in the fragrance and flavor industry, as well as in the synthesis of more complex organic molecules. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular structure and the surrounding conditions. Safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c1-3-4-7-11-8-5-6-9-12(11)14-10(2)13/h3,5-6,8-9H,1,4,7H2,2H3
SMILES:C=CCCc1ccccc1OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
