CAS 890097-70-8

[2-(2-chloroprop-2-enyl)phenyl] acetate

Description:

[2-(2-chloroprop-2-enyl)phenyl] acetate, with the CAS number 890097-70-8, is an organic compound characterized by its ester functional group, which is derived from acetic acid and a substituted phenyl group. This compound features a chloropropenyl moiety, indicating the presence of a double bond and a chlorine atom attached to a propene structure, which contributes to its reactivity and potential applications in organic synthesis. The phenyl ring provides aromatic stability, while the acetate group enhances solubility in organic solvents. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry or agrochemicals. Its structural features suggest potential uses in the development of pharmaceuticals or as an intermediate in chemical synthesis. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its chemical properties.

Formula: C₁₁H₁₁ClO₂

InChI: InChI=1/C11H11ClO2/c1-8(12)7-10-5-3-4-6-11(10)14-9(2)13/h3-6H,1,7H2,2H3

InChI key: InChIKey=ITMCVVDCKLOWOU-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=C(OC(C)=O)C=CC=C1

Synonyms:

• Phenol, 2-(2-chloro-2-propen-1-yl)-, 1-acetate

3-(2-Acetoxyphenyl)-2-chloro-1-propene

CAS: 890097-70-8

Formula: C₁₁H₁₁ClO₂

Molecular weight: 210.6568

Ref: IN-DA0043NV