CAS 890097-72-0

[2-(3-chlorobut-3-enyl)phenyl] acetate

Description:

[2-(3-chlorobut-3-enyl)phenyl] acetate, with the CAS number 890097-72-0, is an organic compound characterized by its phenyl acetate structure modified by a 3-chlorobut-3-enyl group. This compound features a phenyl ring attached to an acetate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorobut-3-enyl moiety introduces both steric and electronic effects, influencing its chemical behavior and interactions. Typically, such compounds may exhibit properties like moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine atom. Additionally, the compound may have implications in fields such as medicinal chemistry or materials science, depending on its specific reactivity and functionalization potential. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.

Formula: C₁₂H₁₃ClO₂

InChI: InChI=1/C12H13ClO2/c1-9(13)7-8-11-5-3-4-6-12(11)15-10(2)14/h3-6H,1,7-8H2,2H3

SMILES: C=C(CCc1ccccc1OC(=O)C)Cl

4-(2-Acetoxyphenyl)-2-chloro-1-butene

CAS: 890097-72-0

Formula: C₁₂H₁₃ClO₂

Molecular weight: 224.6834

Ref: IN-DA0044V1