CAS 890097-74-2
:[2-(2-bromoprop-2-enyl)phenyl] acetate
Description:
[2-(2-bromoprop-2-enyl)phenyl] acetate, with the CAS number 890097-74-2, is an organic compound characterized by its structure, which includes a phenyl ring substituted with an acetate group and a bromopropenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The acetate functional group contributes to its solubility in organic solvents and may influence its reactivity in esterification or hydrolysis reactions. Additionally, the presence of the double bond in the bromopropenyl group can lead to further chemical transformations, such as polymerization or addition reactions. The compound's specific physical properties, such as boiling point, melting point, and density, would depend on its molecular interactions and the presence of functional groups. Overall, [2-(2-bromoprop-2-enyl)phenyl] acetate is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science.
Formula:C11H11BrO2
InChI:InChI=1/C11H11BrO2/c1-8(12)7-10-5-3-4-6-11(10)14-9(2)13/h3-6H,1,7H2,2H3
SMILES:C=C(Cc1ccccc1OC(=O)C)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
