CAS 890097-76-4
:[2-(3-bromobut-3-enyl)phenyl] acetate
Description:
[2-(3-bromobut-3-enyl)phenyl] acetate, with the CAS number 890097-76-4, is an organic compound characterized by its phenyl acetate structure modified by a bromobut-3-enyl group. This compound features a phenyl ring attached to an acetate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom introduces a halogen, which can enhance the compound's electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The but-3-enyl moiety adds a degree of unsaturation, which can also participate in further chemical transformations. This compound may exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, influencing its solubility in organic solvents. Additionally, the presence of the bromine atom may impart specific biological activities, making it of interest in medicinal chemistry. Overall, [2-(3-bromobut-3-enyl)phenyl] acetate is a versatile compound with potential applications in synthetic organic chemistry and pharmaceuticals.
Formula:C12H13BrO2
InChI:InChI=1/C12H13BrO2/c1-9(13)7-8-11-5-3-4-6-12(11)15-10(2)14/h3-6H,1,7-8H2,2H3
SMILES:C=C(CCc1ccccc1OC(=O)C)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
