CymitQuimica logo

CAS 890097-78-6

:

(3-but-3-enylphenyl) acetate

Description:
(3-but-3-enylphenyl) acetate, identified by its CAS number 890097-78-6, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a phenyl ring substituted with a but-3-enyl group, contributing to its unique reactivity and properties. The presence of the double bond in the but-3-enyl moiety introduces unsaturation, which can enhance its reactivity in various chemical reactions, such as polymerization or addition reactions. The acetate group provides a degree of polarity, influencing its solubility in organic solvents. Typically, compounds like (3-but-3-enylphenyl) acetate may exhibit moderate volatility and can have applications in the fragrance industry, as well as in the synthesis of more complex organic molecules. Its specific physical properties, such as boiling point, melting point, and density, would depend on the molecular structure and intermolecular interactions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c1-3-4-6-11-7-5-8-12(9-11)14-10(2)13/h3,5,7-9H,1,4,6H2,2H3
SMILES:C=CCCc1cccc(c1)OC(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.