CAS 890097-81-1

[3-(2-bromoprop-2-enyl)phenyl] acetate

Description:

[3-(2-bromoprop-2-enyl)phenyl] acetate, with the CAS number 890097-81-1, is an organic compound characterized by its phenyl acetate structure modified with a bromopropenyl group. This compound features a phenyl ring attached to an acetate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromopropenyl substituent introduces both steric and electronic effects, influencing its chemical behavior and interactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents, potential reactivity in nucleophilic substitution reactions due to the presence of the bromine atom, and the ability to undergo various transformations in the presence of suitable reagents. Additionally, the compound may have implications in fields such as medicinal chemistry or materials science, depending on its specific reactivity and functionalization potential. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental concerns.

Formula: C₁₁H₁₁BrO₂

InChI: InChI=1/C11H11BrO2/c1-8(12)6-10-4-3-5-11(7-10)14-9(2)13/h3-5,7H,1,6H2,2H3

SMILES: C=C(Cc1cccc(c1)OC(=O)C)Br

3-(3-Acetoxyphenyl)-2-bromo-1-propene

CAS: 890097-81-1

Formula: C₁₁H₁₁BrO₂

Molecular weight: 255.1078

Ref: IN-DA0044V0