CAS 890097-82-2

[3-(3-bromobut-3-enyl)phenyl] acetate

Description:

[3-(3-bromobut-3-enyl)phenyl] acetate, with the CAS number 890097-82-2, is an organic compound characterized by its phenyl acetate structure modified by a bromobut-3-enyl substituent. This compound features a phenyl ring attached to an acetate group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. The double bond in the butenyl chain provides sites for further chemical transformations, such as polymerization or addition reactions. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its properties, such as solubility, boiling point, and melting point, would be influenced by the molecular structure and the presence of functional groups. Overall, [3-(3-bromobut-3-enyl)phenyl] acetate is of interest in the field of organic chemistry for its potential use in the synthesis of more complex molecules.

Formula: C₁₂H₁₃BrO₂

InChI: InChI=1/C12H13BrO2/c1-9(13)6-7-11-4-3-5-12(8-11)15-10(2)14/h3-5,8H,1,6-7H2,2H3

SMILES: C=C(CCc1cccc(c1)OC(=O)C)Br

4-(3-Acetoxyphenyl)-2-bromo-1-butene

CAS: 890097-82-2

Formula: C₁₂H₁₃BrO₂

Molecular weight: 269.1344

Ref: IN-DA0044UZ