CAS 890097-85-5
:[4-(2-chloroprop-2-enyl)phenyl] acetate
Description:
[4-(2-chloroprop-2-enyl)phenyl] acetate, with the CAS number 890097-85-5, is an organic compound characterized by its phenyl acetate structure modified by a 2-chloroprop-2-enyl substituent. This compound features a phenyl ring attached to an acetate group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloropropenyl group introduces both steric and electronic effects, influencing its chemical behavior and interactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions. The chlorinated alkene moiety can also participate in various chemical transformations, making it a valuable intermediate in synthetic organic chemistry. Additionally, the compound's characteristics may include stability under standard conditions, but it could be sensitive to light or heat, depending on the specific environment. Overall, [4-(2-chloroprop-2-enyl)phenyl] acetate represents a versatile structure with potential utility in various chemical applications.
Formula:C11H11ClO2
InChI:InChI=1/C11H11ClO2/c1-8(12)7-10-3-5-11(6-4-10)14-9(2)13/h3-6H,1,7H2,2H3
SMILES:C=C(Cc1ccc(cc1)OC(=O)C)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
