CymitQuimica logo

CAS 890097-86-6

:

[4-(3-chlorobut-3-enyl)phenyl] acetate

Description:
[4-(3-chlorobut-3-enyl)phenyl] acetate, with the CAS number 890097-86-6, is an organic compound characterized by its phenyl acetate structure modified with a 3-chlorobut-3-enyl substituent. This compound features a phenyl ring attached to an acetate group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorobut-3-enyl moiety introduces both a halogen and a double bond, which can enhance its reactivity in various chemical reactions, such as nucleophilic substitutions or polymerizations. The chlorinated alkene structure may also impart unique properties, such as increased lipophilicity or specific interactions with biological targets. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and usage, as the presence of chlorine can indicate potential toxicity or environmental concerns. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis.
Formula:C12H13ClO2
InChI:InChI=1/C12H13ClO2/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-8H,1,3-4H2,2H3
SMILES:C=C(CCc1ccc(cc1)OC(=O)C)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.