CymitQuimica logo

CAS 890097-87-7

:

[4-(2-bromoprop-2-enyl)phenyl] acetate

Description:
[4-(2-bromoprop-2-enyl)phenyl] acetate, with the CAS number 890097-87-7, is an organic compound characterized by its structure, which includes a phenyl ring substituted with an acetate group and a bromopropenyl moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The bromopropenyl group introduces a degree of unsaturation, which may influence its reactivity and stability. Additionally, the acetate functional group can undergo hydrolysis in the presence of water or basic conditions, leading to the release of acetic acid and the corresponding phenol. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its synthesis and applications could be explored in various fields, including pharmaceuticals and agrochemicals, due to the unique properties imparted by its functional groups.
Formula:C11H11BrO2
InChI:InChI=1/C11H11BrO2/c1-8(12)7-10-3-5-11(6-4-10)14-9(2)13/h3-6H,1,7H2,2H3
SMILES:C=C(Cc1ccc(cc1)OC(=O)C)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.