CAS 890097-88-8
:[4-(3-bromobut-3-enyl)phenyl] acetate
Description:
[4-(3-bromobut-3-enyl)phenyl] acetate is an organic compound characterized by its structure, which includes a phenyl ring substituted with a bromobut-3-enyl group and an acetate functional group. This compound features a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the acetate group indicates that it can participate in esterification reactions and may exhibit properties typical of esters, such as volatility and solubility in organic solvents. The bromobut-3-enyl moiety suggests that the compound may have unsaturation, which can lead to further chemical transformations, such as addition reactions. Additionally, the compound's molecular structure may influence its physical properties, such as melting and boiling points, as well as its behavior in various chemical environments. Overall, [4-(3-bromobut-3-enyl)phenyl] acetate is of interest in synthetic organic chemistry, particularly in the development of new materials or pharmaceuticals.
Formula:C12H13BrO2
InChI:InChI=1/C12H13BrO2/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-8H,1,3-4H2,2H3
InChI key:InChIKey=FOMUHGDLYNSVFE-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=CC=C(CCC(Br)=C)C=C1
Synonyms:- Phenol, 4-(3-bromo-3-buten-1-yl)-, 1-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.