CAS 890097-99-1
:8-Chloro-2-oxooctanoic acid
Description:
8-Chloro-2-oxooctanoic acid, with the CAS number 890097-99-1, is a chemical compound characterized by its unique structure, which includes a chloro substituent and a keto group within an octanoic acid framework. This compound typically exhibits properties associated with carboxylic acids, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorine atom introduces additional reactivity, potentially allowing for further chemical transformations. As an oxo acid, it may participate in reactions typical of carbonyl-containing compounds, such as nucleophilic additions. Its applications may span various fields, including pharmaceuticals and agrochemicals, where it could serve as an intermediate or active ingredient. The specific physical properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. Overall, 8-Chloro-2-oxooctanoic acid represents a versatile compound with potential utility in synthetic chemistry.
Formula:C8H13ClO3
InChI:InChI=1S/C8H13ClO3/c9-6-4-2-1-3-5-7(10)8(11)12/h1-6H2,(H,11,12)
InChI key:InChIKey=PXSUXATXOJIUKU-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)=O)CCCCCCl
Synonyms:- Octanoic acid, 8-chloro-2-oxo-
- 8-Chloro-2-oxooctanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
