CAS 890098-01-8
:ethyl 5-(3-thienyl)pentanoate
Description:
Ethyl 5-(3-thienyl)pentanoate is an organic compound characterized by its ester functional group, which is formed from the reaction of pentanoic acid and ethanol. This compound features a five-carbon pentanoate chain with a thienyl group, a sulfur-containing heterocyclic aromatic ring, attached at the fifth carbon. The presence of the thienyl group imparts unique electronic and steric properties, making it of interest in various chemical applications, including potential uses in pharmaceuticals and agrochemicals. Ethyl 5-(3-thienyl)pentanoate is typically a colorless to pale yellow liquid with a pleasant odor, indicative of its ester nature. Its solubility in organic solvents and limited solubility in water are typical for esters, which can influence its behavior in biological systems and its applications in synthesis. The compound's stability, reactivity, and potential interactions with other substances are influenced by its molecular structure, making it a subject of interest in both synthetic and applied chemistry.
Formula:C11H16O2S
InChI:InChI=1/C11H16O2S/c1-2-13-11(12)6-4-3-5-10-7-8-14-9-10/h7-9H,2-6H2,1H3
SMILES:CCOC(=O)CCCCc1ccsc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.