CAS 890098-02-9
:Ethyl 3-thiophenehexanoate
Description:
Ethyl 3-thiophenehexanoate is an organic compound characterized by its ester functional group, which is formed from the reaction of ethyl alcohol and a thiophene-containing carboxylic acid. This compound features a thiophene ring, a five-membered aromatic heterocycle containing sulfur, which contributes to its unique chemical properties and potential applications in organic synthesis and materials science. Ethyl 3-thiophenehexanoate typically exhibits moderate solubility in organic solvents, making it useful in various chemical reactions and formulations. Its structure suggests it may possess interesting electronic properties due to the presence of the thiophene moiety, which can participate in π-π stacking interactions. Additionally, the hexanoate chain can influence its physical properties, such as boiling point and viscosity. While specific data on its reactivity and stability may vary, compounds of this nature are often explored for their potential in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H18O2S
InChI:InChI=1S/C12H18O2S/c1-2-14-12(13)7-5-3-4-6-11-8-9-15-10-11/h8-10H,2-7H2,1H3
InChI key:InChIKey=IVEGEKHCZZGZOH-UHFFFAOYSA-N
SMILES:C(CCCCC(OCC)=O)C=1C=CSC1
Synonyms:- 3-Thiophenehexanoic acid, ethyl ester
- Ethyl 3-thiophenehexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
