CAS 890098-03-0
:2-Bromo-α-(4-bromophenyl)-5-methoxybenzenemethanol
Description:
2-Bromo-α-(4-bromophenyl)-5-methoxybenzenemethanol is an organic compound characterized by its complex structure, which includes multiple bromine substituents and a methoxy group. This compound features a benzene ring with a methanol functional group, indicating it has both aromatic and alcohol characteristics. The presence of bromine atoms suggests that it may exhibit enhanced reactivity, particularly in electrophilic substitution reactions. The methoxy group can influence the compound's electronic properties, potentially affecting its solubility and reactivity. Additionally, the compound's structure may confer specific biological activities, making it of interest in medicinal chemistry. Its molecular weight and specific physical properties, such as melting point and solubility, would depend on the arrangement of its substituents and the overall molecular structure. As with many brominated compounds, it is essential to consider environmental and safety aspects, as brominated organic compounds can have implications for toxicity and bioaccumulation. Overall, 2-Bromo-α-(4-bromophenyl)-5-methoxybenzenemethanol is a notable compound for further study in various chemical and pharmaceutical applications.
Formula:C14H12Br2O2
InChI:InChI=1S/C14H12Br2O2/c1-18-11-6-7-13(16)12(8-11)14(17)9-2-4-10(15)5-3-9/h2-8,14,17H,1H3
InChI key:InChIKey=AFTFCBBUAHJYAB-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=CC=C1Br)C2=CC=C(Br)C=C2
Synonyms:- Benzenemethanol, 2-bromo-α-(4-bromophenyl)-5-methoxy-
- 2-Bromo-α-(4-bromophenyl)-5-methoxybenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
