CAS 890098-04-1

(2-chlorophenyl)-(2-methoxyphenyl)methanone

Description:

(2-chlorophenyl)-(2-methoxyphenyl)methanone, with the CAS number 890098-04-1, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to two aromatic rings. The presence of a chlorine atom on one phenyl ring and a methoxy group (-OCH3) on the other contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound may exhibit moderate polarity due to the electronegative chlorine and oxygen atoms, influencing its interactions in various chemical environments. It is likely to be stable under standard conditions but may undergo reactions typical of ketones, such as nucleophilic addition or oxidation. The compound's structural features suggest potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1/C14H11ClO2/c1-17-13-9-5-3-7-11(13)14(16)10-6-2-4-8-12(10)15/h2-9H,1H3

SMILES: COc1ccccc1C(=O)c1ccccc1Cl

Synonyms:

• Methanone, (2-Chlorophenyl)(2-Methoxyphenyl)-

2-Chloro-2'-methoxybenzophenone

CAS: 890098-04-1

Formula: C₁₄H₁₁ClO₂

Molecular weight: 246.6889

Ref: IN-DA0088OI

2-Chloro-2′-methoxybenzophenone

CAS: 890098-04-1

Formula: C₁₄H₁₁ClO₂

Purity: 97.0%

Molecular weight: 246.69

Ref: 10-F201534

(2-Chlorophenyl)(2-methoxyphenyl)methanone

CAS: 890098-04-1

Versatile small molecule scaffold

Formula: C₁₄H₁₁ClO₂

Purity: Min. 95%

Molecular weight: 246.69 g/mol

Ref: 3D-QKB09804