CAS 890098-08-5
:(2-Fluorophenyl)(3-methoxyphenyl)methanone
Description:
(2-Fluorophenyl)(3-methoxyphenyl)methanone, with the CAS number 890098-08-5, is an organic compound characterized by its structure, which includes a fluorinated phenyl group and a methoxy-substituted phenyl group attached to a carbonyl (ketone) functional group. This compound typically exhibits properties associated with aromatic ketones, such as a relatively high melting point and boiling point due to the presence of the aromatic rings. The fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its lipophilicity and affecting its interaction with biological systems. The methoxy group contributes to the compound's electron-donating characteristics, which can modulate its chemical behavior. In terms of applications, compounds like this may be explored in medicinal chemistry for their potential biological activities, including anti-inflammatory or anticancer properties. However, specific reactivity and stability can vary based on the surrounding conditions and the presence of other functional groups. As with all chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C14H11FO2
InChI:InChI=1S/C14H11FO2/c1-17-11-6-4-5-10(9-11)14(16)12-7-2-3-8-13(12)15/h2-9H,1H3
InChI key:InChIKey=BOCOITOJOGVWRB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC=C1)C2=C(F)C=CC=C2
Synonyms:- 2-Fluoro-3′-methoxybenzophenone
- Methanone, (2-fluorophenyl)(3-methoxyphenyl)-
- (2-Fluorophenyl)(3-methoxyphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.