CAS 890098-11-0
:(4-bromophenyl)-(2-iodophenyl)methanone
Description:
(4-bromophenyl)-(2-iodophenyl)methanone, with the CAS number 890098-11-0, is an organic compound characterized by the presence of both bromine and iodine substituents on its phenyl rings. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The bromine and iodine atoms introduce significant steric and electronic effects, influencing the compound's reactivity, stability, and interaction with other chemical species. Typically, such halogenated compounds exhibit interesting properties, including enhanced lipophilicity and potential biological activity, making them of interest in medicinal chemistry and material science. The presence of halogens can also facilitate various chemical transformations, such as nucleophilic substitutions or coupling reactions. As with many organic compounds, the physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated organic compounds.
Formula:C13H8BrIO
InChI:InChI=1/C13H8BrIO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H
SMILES:c1ccc(c(c1)C(=O)c1ccc(cc1)Br)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
