CAS 890098-16-5

Methanone, (3-chlorophenyl)(3-iodophenyl)-

Description:

Methanone, (3-chlorophenyl)(3-iodophenyl)-, also known by its CAS number 890098-16-5, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The compound features a chlorophenyl group and an iodophenyl group, which contribute to its unique chemical properties. The presence of halogen substituents, specifically chlorine and iodine, can influence the compound's reactivity, stability, and solubility. Generally, such compounds may exhibit interesting biological activities and can serve as intermediates in organic synthesis. The molecular structure typically leads to a planar configuration, allowing for potential π-π stacking interactions in solid-state forms. Additionally, the presence of electronegative halogens can affect the electron density around the aromatic rings, potentially enhancing electrophilic or nucleophilic reactivity. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, and organic synthesis due to its unique structural features and potential applications.

Formula: C₁₃H₈ClIO

InChI: InChI=1S/C13H8ClIO/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H

InChI key: InChIKey=WQXXLXCQGLENBQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC(I)=CC=C2

Synonyms:

• (3-Chlorophenyl)(3-iodophenyl)methanone
• Methanone, (3-chlorophenyl)(3-iodophenyl)-