CAS 890098-17-6

(2-chlorophenyl)-(4-iodophenyl)methanone

Description:

(2-chlorophenyl)-(4-iodophenyl)methanone, identified by its CAS number 890098-17-6, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a chlorinated phenyl group at the 2-position and an iodinated phenyl group at the 4-position, contributing to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its non-polar aromatic nature. The presence of halogens (chlorine and iodine) can influence its chemical behavior, including reactivity in electrophilic substitution reactions and potential applications in medicinal chemistry or material science. Additionally, the compound may display interesting photophysical properties, making it a candidate for studies in organic electronics or as a dye. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, (2-chlorophenyl)-(4-iodophenyl)methanone is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₃H₈ClIO

InChI: InChI=1/C13H8ClIO/c14-12-4-2-1-3-11(12)13(16)9-5-7-10(15)8-6-9/h1-8H

SMILES: c1ccc(c(c1)C(=O)c1ccc(cc1)I)Cl