CAS 890098-20-1
:(2-Fluorophenyl)(3-nitrophenyl)methanone
Description:
(2-Fluorophenyl)(3-nitrophenyl)methanone, with the CAS number 890098-20-1, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a fluorine atom on the second position of one phenyl ring and a nitro group at the third position of the other phenyl ring, contributing to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine and nitro groups, which can influence its solubility in various solvents. The presence of these substituents may also affect its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit interesting biological activities, which could be explored in pharmaceutical research. Its stability and behavior under different conditions would depend on the specific environment and the presence of other reactive species. Overall, (2-Fluorophenyl)(3-nitrophenyl)methanone is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C13H8FNO3
InChI:InChI=1S/C13H8FNO3/c14-12-7-2-1-6-11(12)13(16)9-4-3-5-10(8-9)15(17)18/h1-8H
InChI key:InChIKey=VTHDJBOODPAHJV-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=CC=C1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- (2-Fluorophenyl)(3-nitrophenyl)methanone
- 2-Fluoro-3′-nitrobenzophenone
- Methanone, (2-fluorophenyl)(3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.