CAS 890098-21-2
:(3-fluorophenyl)-(3-nitrophenyl)methanone
Description:
(3-Fluorophenyl)-(3-nitrophenyl)methanone, with the CAS number 890098-21-2, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a fluorine atom on one phenyl ring and a nitro group on the other, which can influence its chemical reactivity and physical properties. The presence of the fluorine atom typically enhances the compound's lipophilicity and may affect its electronic properties, while the nitro group can serve as a strong electron-withdrawing group, impacting the compound's reactivity in electrophilic aromatic substitution reactions. This compound may exhibit significant biological activity, making it of interest in medicinal chemistry and material science. Its solubility, melting point, and stability can vary based on environmental conditions and the presence of solvents. Overall, the unique combination of functional groups in (3-fluorophenyl)-(3-nitrophenyl)methanone contributes to its potential applications in various chemical and pharmaceutical contexts.
Formula:C13H8FNO3
InChI:InChI=1/C13H8FNO3/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(8-10)15(17)18/h1-8H
SMILES:c1cc(cc(c1)F)C(=O)c1cccc(c1)N(=O)=O
Synonyms:- Methanone, (3-fluorophenyl)(3-nitrophenyl)-
- 3-FLUORO-3'-NITROBENZOPHENONE
- (3-fluorophenyl)-(3-nitrophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.