CAS 890098-22-3
:(2-fluorophenyl)-(2-iodophenyl)methanone
Description:
(2-Fluorophenyl)-(2-iodophenyl)methanone, with the CAS number 890098-22-3, is an organic compound characterized by the presence of both fluorine and iodine substituents on phenyl rings attached to a ketone functional group. This compound features a central carbonyl group (C=O) bonded to two distinct aromatic rings: one containing a fluorine atom at the ortho position and the other containing an iodine atom at the ortho position as well. The presence of these halogens can significantly influence the compound's reactivity, polarity, and overall chemical behavior. Generally, compounds with halogen substituents exhibit altered electronic properties, which can affect their interactions in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the ketone functional group suggests potential applications in organic synthesis and medicinal chemistry, where such compounds may serve as intermediates or active pharmaceutical ingredients. The compound's physical properties, such as solubility and melting point, would depend on the specific interactions between the halogen atoms and the surrounding environment.
Formula:C13H8FIO
InChI:InChI=1/C13H8FIO/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8H
SMILES:c1ccc(c(c1)C(=O)c1ccccc1I)F
Synonyms:- (2-Fluorophenyl)-(2-iodophenyl)-methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
