CAS 890098-24-5
:(2-fluorophenyl)-(3-iodophenyl)methanone
Description:
(2-Fluorophenyl)-(3-iodophenyl)methanone, identified by its CAS number 890098-24-5, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The compound features a fluorine atom at the para position of one phenyl ring and an iodine atom at the meta position of the other, contributing to its unique reactivity and properties. The presence of halogens, such as fluorine and iodine, can significantly influence the compound's electronic properties, making it potentially useful in various chemical reactions, including electrophilic substitutions. Additionally, the steric and electronic effects of these substituents may affect the compound's solubility, stability, and interaction with biological systems. As a ketone, it may also participate in condensation reactions or serve as a precursor for further synthetic transformations. Overall, this compound's distinct structural features make it of interest in medicinal chemistry and materials science, where halogenated compounds often exhibit enhanced biological activity or unique physical properties.
Formula:C13H8FIO
InChI:InChI=1/C13H8FIO/c14-12-7-2-1-6-11(12)13(16)9-4-3-5-10(15)8-9/h1-8H
SMILES:c1ccc(c(c1)C(=O)c1cccc(c1)I)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
