CAS 890098-29-0
:ethyl 3-(3-nitrobenzoyl)benzoate
Description:
Ethyl 3-(3-nitrobenzoyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a nitro group attached to a benzoyl moiety, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the nitro group typically enhances the electrophilic character of the aromatic ring, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Ethyl 3-(3-nitrobenzoyl)benzoate is likely to exhibit moderate solubility in organic solvents due to its aromatic structure, while its melting and boiling points would be influenced by the molecular interactions present in the solid and liquid states. Additionally, the compound may display specific UV-Vis absorption characteristics due to the conjugated system of the aromatic rings, which can be utilized in analytical applications. Safety data should be consulted for handling and storage, as nitro compounds can pose health risks.
Formula:C16H13NO5
InChI:InChI=1/C16H13NO5/c1-2-22-16(19)13-7-3-5-11(9-13)15(18)12-6-4-8-14(10-12)17(20)21/h3-10H,2H2,1H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)c1cccc(c1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
