CAS 890098-32-5

[2-(3-nitrobenzoyl)phenyl] acetate

Description:

[2-(3-Nitrobenzoyl)phenyl] acetate, with the CAS number 890098-32-5, is an organic compound characterized by its structure, which includes a phenyl acetate moiety substituted with a 3-nitrobenzoyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. It is likely to be soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The nitro group introduces electron-withdrawing characteristics, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the acetate group may confer some degree of stability and influence the compound's behavior in various chemical environments. Overall, [2-(3-nitrobenzoyl)phenyl] acetate is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or as an intermediate in chemical synthesis.

Formula: C₁₅H₁₁NO₅

InChI: InChI=1/C15H11NO5/c1-10(17)21-14-8-3-2-7-13(14)15(18)11-5-4-6-12(9-11)16(19)20/h2-9H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1cccc(c1)N(=O)=O

2-Acetoxy-3'-nitrobenzophenone

CAS: 890098-32-5

Formula: C₁₅H₁₁NO₅

Molecular weight: 285.2515

Ref: IN-DA0043NE