CAS 890098-33-6
:ethyl 2-(2-iodobenzoyl)benzoate
Description:
Ethyl 2-(2-iodobenzoyl)benzoate is an organic compound characterized by its ester functional group, specifically an ethyl ester derived from benzoic acid. It features a benzoyl moiety substituted with an iodine atom at the ortho position relative to the ester group, which can influence its reactivity and physical properties. The presence of the iodine atom typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its hydrophobic aromatic structure. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit interesting photophysical properties due to the presence of the aromatic rings, which can be explored in materials science or dye applications. As with many halogenated compounds, safety precautions should be taken when handling ethyl 2-(2-iodobenzoyl)benzoate, as halogens can pose health risks.
Formula:C16H13IO3
InChI:InChI=1/C16H13IO3/c1-2-20-16(19)12-8-4-3-7-11(12)15(18)13-9-5-6-10-14(13)17/h3-10H,2H2,1H3
SMILES:CCOC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
