CAS 890098-38-1

Methanone, [2-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-

Description:

Methanone, specifically the compound known as [2-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-, is an organic molecule characterized by its complex structure that includes both acetyloxy and methylethoxy functional groups attached to phenyl rings. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity due to the presence of electron-donating and electron-withdrawing groups. The acetyloxy group can enhance solubility in organic solvents and may influence the compound's reactivity in various chemical reactions, including esterification and nucleophilic substitutions. The methylethoxy group contributes to the steric hindrance and can affect the compound's overall polarity and interaction with biological systems. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or materials science, depending on its reactivity and functional characteristics.

Formula: C₁₈H₁₈O₄

InChI: InChI=1S/C18H18O4/c1-12(2)21-15-10-8-14(9-11-15)18(20)16-6-4-5-7-17(16)22-13(3)19/h4-12H,1-3H3

InChI key: InChIKey=UHGVSYCXDYVSAR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(OC(C)C)C=C2

Synonyms:

• 2-(4-Isopropoxybenzoyl)phenyl acetate
• 2-Acetoxy-4′-isopropoxybenzophenone
• Methanone, [2-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-

2-Acetoxy-4'-isopropoxybenzophenone

CAS: 890098-38-1

Formula: C₁₈H₁₈O₄

Molecular weight: 298.3331

Ref: IN-DA0043NA

2-Acetoxy-4′-isopropoxybenzophenone

CAS: 890098-38-1

Formula: C₁₈H₁₈O₄

Purity: 90.0%

Molecular weight: 298.338

Ref: 10-F201723