CAS 890098-40-5

Methanone, [2-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-

Description:

Methanone, [2-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of an acetyloxy group indicates that it has an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The compound features a bulky tert-butyl group on one of the phenyl rings, which can influence its steric properties and solubility. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its molecular structure suggests potential uses in materials science or as a precursor in the synthesis of more complex organic molecules. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as temperature and solvent. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₉H₂₀O₃

InChI: InChI=1S/C19H20O3/c1-13(20)22-17-8-6-5-7-16(17)18(21)14-9-11-15(12-10-14)19(2,3)4/h5-12H,1-4H3

InChI key: InChIKey=XHWTUMZIEUKXES-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 2-Acetoxy-4′-t-butylbenzophenone
• Methanone, [2-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-
• 2-(4-tert-Butylbenzoyl)phenyl acetate

2-Acetoxy-4'-t-butylbenzophenone

CAS: 890098-40-5

Formula: C₁₉H₂₀O₃

Molecular weight: 296.3603

Ref: IN-DA0043N9