CAS 890098-44-9
:Methanone, [2-(acetyloxy)phenyl](4-butylphenyl)-
Description:
Methanone, [2-(acetyloxy)phenyl](4-butylphenyl)-, also known by its CAS number 890098-44-9, is an organic compound characterized by its complex structure that includes a methanone functional group and aromatic rings. This compound features an acetyloxy group attached to a phenyl ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of a butyl group on another phenyl ring enhances its hydrophobic properties, influencing its solubility and interaction with biological systems. Methanone derivatives often exhibit interesting pharmacological activities, making them subjects of research in medicinal chemistry. The compound's molecular structure suggests potential uses in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its stability and reactivity can be influenced by the substituents on the aromatic rings, which can affect electronic distribution and steric hindrance. Overall, this compound represents a class of methanones that are valuable in various chemical applications due to their unique structural features.
Formula:C19H20O3
InChI:InChI=1S/C19H20O3/c1-3-4-7-15-10-12-16(13-11-15)19(21)17-8-5-6-9-18(17)22-14(2)20/h5-6,8-13H,3-4,7H2,1-2H3
InChI key:InChIKey=IQBWFQOIRQIONO-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(CCCC)C=C2
Synonyms:- Methanone, [2-(acetyloxy)phenyl](4-butylphenyl)-
- 2-Acetoxy-4′-butylbenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
