CAS 890098-46-1

[2-(4-pentylbenzoyl)phenyl] acetate

Description:

[2-(4-pentylbenzoyl)phenyl] acetate, with the CAS number 890098-46-1, is an organic compound characterized by its structure, which includes an acetate functional group and a phenyl ring substituted with a pentylbenzoyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a solid at room temperature, given the presence of long alkyl chains that can enhance its melting point. The presence of the acetate group suggests it may have moderate solubility in organic solvents while being less soluble in water. Additionally, the compound may exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics or as a photoinitiator in polymerization processes. Its specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or detailed literature references for precise values.

Formula: C₂₀H₂₂O₃

InChI: InChI=1/C20H22O3/c1-3-4-5-8-16-11-13-17(14-12-16)20(22)18-9-6-7-10-19(18)23-15(2)21/h6-7,9-14H,3-5,8H2,1-2H3

SMILES: CCCCCc1ccc(cc1)C(=O)c1ccccc1OC(=O)C

2-Acetoxy-4′-pentylbenzophenone

CAS: 890098-46-1

Formula: C₂₀H₂₂O₃

Purity: 90.0%

Molecular weight: 310.393

Ref: 10-F201728