CAS 890098-48-3

Methanone, [2-(acetyloxy)phenyl](4-hexylphenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](4-hexylphenyl)-, also known by its CAS number 890098-48-3, is an organic compound characterized by its complex structure that includes both aromatic and aliphatic components. This substance features a methanone functional group, which is indicative of a ketone, and is further substituted with an acetyloxy group and a hexylphenyl moiety. The presence of the acetyloxy group suggests potential reactivity and solubility in organic solvents, while the hexylphenyl group contributes to its hydrophobic characteristics. The compound is likely to exhibit interesting photophysical properties, making it of interest in fields such as materials science and organic electronics. Its molecular structure may also influence its thermal stability and potential applications in various chemical processes. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly. Overall, this compound represents a unique combination of functional groups that could be explored for various applications in research and industry.

Formula: C₂₁H₂₄O₃

InChI: InChI=1S/C21H24O3/c1-3-4-5-6-9-17-12-14-18(15-13-17)21(23)19-10-7-8-11-20(19)24-16(2)22/h7-8,10-15H,3-6,9H2,1-2H3

InChI key: InChIKey=JAQQPPLFTNKZSO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(CCCCCC)C=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](4-hexylphenyl)-

2-Acetoxy-4'-hexylbenzophenone

CAS: 890098-48-3

Formula: C₂₁H₂₄O₃

Molecular weight: 324.4135

Ref: IN-DA0043N6

2-Acetoxy-4′-hexylbenzophenone

CAS: 890098-48-3

Formula: C₂₁H₂₄O₃

Purity: 90.0%

Molecular weight: 324.42

Ref: 10-F201729