CymitQuimica logo

CAS 890098-51-8

:

(2-iodophenyl)-(2-methylsulfanylphenyl)methanone

Description:
(2-Iodophenyl)-(2-methylsulfanylphenyl)methanone, with the CAS number 890098-51-8, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of an iodine atom on one of the phenyl groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methylthio group (–S–CH3) on the second phenyl ring enhances its electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological targets. This compound may exhibit interesting pharmacological activities due to the combination of the iodine and methylthio substituents, which can affect its lipophilicity and binding affinity. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, (2-iodophenyl)-(2-methylsulfanylphenyl)methanone represents a versatile building block in synthetic organic chemistry, with potential applications in drug development and material science.
Formula:C14H11IOS
InChI:InChI=1/C14H11IOS/c1-17-13-9-5-3-7-11(13)14(16)10-6-2-4-8-12(10)15/h2-9H,1H3
SMILES:CSc1ccccc1C(=O)c1ccccc1I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.