CAS 890098-55-2

(4-Iodophenyl)[2-(methylthio)phenyl]methanone

Description:

(4-Iodophenyl)[2-(methylthio)phenyl]methanone, with the CAS number 890098-55-2, is an organic compound characterized by its complex structure that includes a ketone functional group and multiple aromatic rings. The presence of an iodine atom on the para position of one phenyl ring enhances its reactivity and can influence its electronic properties, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The methylthio group attached to the second phenyl ring contributes to the compound's overall polarity and can affect its solubility in different solvents. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves the introduction of the iodine and methylthio groups onto the phenyl rings, followed by the formation of the ketone. The compound's stability, reactivity, and potential applications in organic synthesis or pharmaceuticals can be influenced by the substituents on the aromatic rings, making it a subject of study in both academic and industrial chemistry contexts.

Formula: C₁₄H₁₁IOS

InChI: InChI=1S/C14H11IOS/c1-17-13-5-3-2-4-12(13)14(16)10-6-8-11(15)9-7-10/h2-9H,1H3

InChI key: InChIKey=SUPNWODLEAVXDB-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC=C(I)C=C2

Synonyms:

• (4-Iodophenyl)[2-(methylsulfanyl)phenyl]methanone
• (4-Iodophenyl)[2-(methylthio)phenyl]methanone
• Methanone, (4-iodophenyl)[2-(methylthio)phenyl]-

4-Iodo-2′-thiomethylbenzophenone

CAS: 890098-55-2

Formula: C₁₄H₁₁IOS

Purity: 95.0%

Molecular weight: 354.21

Ref: 10-F201671