CAS 890098-60-9

[2-(4-hexoxybenzoyl)phenyl] acetate

Description:

[2-(4-hexoxybenzoyl)phenyl] acetate, with the CAS number 890098-60-9, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a phenyl ring substituted with a hexoxybenzoyl group, contributing to its unique properties. The presence of the hexoxy chain enhances its solubility in organic solvents and may influence its hydrophobic characteristics. Typically, compounds like this can exhibit interesting thermal and photophysical properties, making them suitable for applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) or as intermediates in organic synthesis. Additionally, the molecular structure suggests potential for interactions with biological systems, although specific biological activity would require further investigation. Overall, [2-(4-hexoxybenzoyl)phenyl] acetate represents a versatile compound with potential applications in various fields, including organic chemistry and materials science.

Formula: C₂₁H₂₄O₄

InChI: InChI=1/C21H24O4/c1-3-4-5-8-15-24-18-13-11-17(12-14-18)21(23)19-9-6-7-10-20(19)25-16(2)22/h6-7,9-14H,3-5,8,15H2,1-2H3

SMILES: CCCCCCOc1ccc(cc1)C(=O)c1ccccc1OC(=O)C