CymitQuimica logo

CAS 890098-61-0

:

(4-iodophenyl)-(4-methylsulfanylphenyl)methanone

Description:
(4-Iodophenyl)-(4-methylsulfanylphenyl)methanone, identified by its CAS number 890098-61-0, is an organic compound characterized by its unique molecular structure, which includes a ketone functional group and two aromatic rings. The presence of an iodine atom on one phenyl ring and a methylthio group on the other contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, which can influence its solubility and interaction with biological systems. Additionally, the iodine substituent may impart specific properties such as increased electron density or altered steric effects, while the methylthio group can enhance nucleophilicity. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the synthesis of novel compounds or as a potential intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of iodine and the potential for toxicity associated with certain organosulfur compounds.
Formula:C14H11IOS
InChI:InChI=1/C14H11IOS/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3
SMILES:CSc1ccc(cc1)C(=O)c1ccc(cc1)I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.