CAS 890098-65-4
:4-(3-iodobenzoyl)benzonitrile
Description:
4-(3-Iodobenzoyl)benzonitrile is an organic compound characterized by its structure, which includes a benzonitrile moiety and an iodobenzoyl group. The presence of the iodo substituent enhances its reactivity and can influence its physical properties, such as solubility and melting point. This compound typically appears as a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both the nitrile and carbonyl functional groups, which can participate in various chemical reactions. Additionally, the iodo group can serve as a useful handle for further functionalization or coupling reactions. The compound's properties, such as polarity and reactivity, can be influenced by the electronic effects of the iodine atom and the overall aromatic character of the molecule. As with many halogenated compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.
Formula:C14H8INO
InChI:InChI=1/C14H8INO/c15-13-3-1-2-12(8-13)14(17)11-6-4-10(9-16)5-7-11/h1-8H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
