CAS 890098-68-7

Methanone, [2-(acetyloxy)phenyl](2,5-difluorophenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](2,5-difluorophenyl)-, also known by its CAS number 890098-68-7, is an organic compound characterized by its complex structure that includes both acetyloxy and difluorophenyl groups. This compound features a methanone functional group, which is indicative of a ketone, and is further substituted with an acetyloxy group at one phenyl ring and a difluorophenyl group at another. The presence of fluorine atoms in the difluorophenyl moiety can significantly influence the compound's reactivity, stability, and lipophilicity, making it of interest in medicinal chemistry and material science. The acetyloxy group may enhance solubility and reactivity, potentially allowing for various chemical transformations. Overall, this compound's unique functional groups suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities or applications would require further investigation.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1S/C15H10F2O3/c1-9(18)20-14-5-3-2-4-11(14)15(19)12-8-10(16)6-7-13(12)17/h2-8H,1H3

InChI key: InChIKey=KPOQGMCZRSWKNM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=C(F)C=CC(F)=C2

Synonyms:

• 2-Acetoxy-2′,5′-difluorobenzophenone
• Methanone, [2-(acetyloxy)phenyl](2,5-difluorophenyl)-
• 2-(2,5-Difluorobenzoyl)phenyl acetate

2-Acetoxy-2′,5′-difluorobenzophenone

CAS: 890098-68-7

Formula: C₁₅H₁₀F₂O₃

Purity: 90.0%

Molecular weight: 276.239

Ref: 10-F201739