CAS 890098-72-3

Methanone, [2-(acetyloxy)phenyl](3,4-difluorophenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](3,4-difluorophenyl)-, also known by its CAS number 890098-72-3, is an organic compound characterized by its complex structure that includes a methanone functional group and two aromatic rings. The presence of the acetyloxy group indicates that it has an ester functional group, which can influence its reactivity and solubility. The difluorophenyl substituent suggests that the compound may exhibit unique electronic properties due to the electronegative fluorine atoms, potentially affecting its chemical behavior and interactions. This compound may be of interest in medicinal chemistry or materials science due to its potential biological activity or utility in synthesizing other chemical entities. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental studies or computational modeling. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₀F₂O₃

InChI: InChI=1/C15H10F2O3/c1-9(18)20-14-5-3-2-4-11(14)15(19)10-6-7-12(16)13(17)8-10/h2-8H,1H3

InChI key: InChIKey=KWGKYQWIEGMZMH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC(F)=C(F)C=C2

Synonyms:

• 2-(3,4-Difluorobenzoyl)phenyl acetate
• Methanone, [2-(acetyloxy)phenyl](3,4-difluorophenyl)-
• 2-Acetoxy-3′,4′-difluorobenzophenone

2-Acetoxy-3′,4′-difluorobenzophenone

CAS: 890098-72-3

Formula: C₁₅H₁₀F₂O₃

Purity: 90.0%

Molecular weight: 276.239

Ref: 10-F201741