CymitQuimica logo

CAS 890098-76-7

:

[2-(2,3-dichlorobenzoyl)phenyl] acetate

Description:
[2-(2,3-Dichlorobenzoyl)phenyl] acetate, with the CAS number 890098-76-7, is an organic compound characterized by its complex structure, which includes a phenyl acetate moiety and a dichlorobenzoyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing chlorine atoms. The dichlorobenzoyl group can enhance the compound's lipophilicity, influencing its solubility in organic solvents. Additionally, the presence of chlorine substituents may impart unique electronic properties, affecting its reactivity in various chemical reactions, including electrophilic aromatic substitution. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves acylation reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, [2-(2,3-dichlorobenzoyl)phenyl] acetate represents a versatile compound with potential applications in various fields of chemistry.
Formula:C15H10Cl2O3
InChI:InChI=1/C15H10Cl2O3/c1-9(18)20-13-8-3-2-5-10(13)15(19)11-6-4-7-12(16)14(11)17/h2-8H,1H3
SMILES:CC(=O)Oc1ccccc1C(=O)c1cccc(c1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.