CAS 890098-85-8
:[2-(Acetyloxy)phenyl](4-methoxyphenyl)methanone
Description:
The chemical substance known as [2-(Acetyloxy)phenyl](4-methoxyphenyl)methanone, with the CAS number 890098-85-8, is an organic compound characterized by its complex structure, which includes an acetoxy group and a methoxy group attached to phenyl rings. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of functional groups. The acetoxy group can enhance solubility in organic solvents, while the methoxy group may influence the compound's electronic properties and reactivity. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential biological activities, including anti-inflammatory or anticancer properties. The presence of multiple functional groups suggests that this compound could participate in various chemical reactions, such as esterification or nucleophilic substitution. Overall, [2-(Acetyloxy)phenyl](4-methoxyphenyl)methanone represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-11(17)20-15-6-4-3-5-14(15)16(18)12-7-9-13(19-2)10-8-12/h3-10H,1-2H3
InChI key:InChIKey=GDXIVMHHTLDFQS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(OC)C=C2
Synonyms:- [2-(Acetyloxy)phenyl](4-methoxyphenyl)methanone
- 2-(4-Methoxybenzoyl)phenyl acetate
- Methanone, [2-(acetyloxy)phenyl](4-methoxyphenyl)-
- 2-Acetoxy-4′-methoxybenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
