CAS 890098-88-1

Methanone, [2-(acetyloxy)phenyl](2,3-dimethoxyphenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](2,3-dimethoxyphenyl)-, also known by its CAS number 890098-88-1, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features an acetyloxy group attached to a phenyl ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of two methoxy groups on the adjacent phenyl ring enhances its electron-donating properties, influencing its chemical behavior and interactions. Methanone derivatives often exhibit interesting biological activities, making them subjects of research in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on its substituents and the overall molecular structure. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound exemplifies the diversity of organic chemistry and the potential for creating novel materials with specific properties.

Formula: C₁₇H₁₆O₅

InChI: InChI=1S/C17H16O5/c1-11(18)22-14-9-5-4-7-12(14)16(19)13-8-6-10-15(20-2)17(13)21-3/h4-10H,1-3H3

InChI key: InChIKey=ATKZONNUYVPZTJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C(OC)=CC=C1)C2=C(OC(C)=O)C=CC=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](2,3-dimethoxyphenyl)-
• 2-(2,3-Dimethoxybenzoyl)phenyl acetate

2-Acetoxy-2′,3′-methoxybenzophenone

CAS: 890098-88-1

Formula: C₁₇H₁₆O₅

Purity: 90.0%

Molecular weight: 300.31

Ref: 10-F201749