CAS 890098-93-8

[2-[2-(trifluoromethyl)benzoyl]phenyl] acetate

Description:

The chemical substance known as [2-[2-(trifluoromethyl)benzoyl]phenyl] acetate, with the CAS number 890098-93-8, is an organic compound characterized by its complex structure, which includes a trifluoromethyl group and an acetate moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions due to the presence of electron-withdrawing groups like the trifluoromethyl group. The trifluoromethyl group enhances the lipophilicity and may influence the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, the acetate functional group can participate in esterification and hydrolysis reactions. The compound's solubility, melting point, and boiling point would depend on its specific molecular interactions and the presence of functional groups. Overall, this substance may be utilized in research and development, particularly in the fields of medicinal chemistry and materials science, due to its unique structural features and potential reactivity.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1/C16H11F3O3/c1-10(20)22-14-9-5-3-7-12(14)15(21)11-6-2-4-8-13(11)16(17,18)19/h2-9H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1ccccc1C(F)(F)F

2-Acetoxy-2′-trifluorobenzophenone

CAS: 890098-93-8

Formula: C₁₆H₁₁F₃O₃

Purity: 90.0%

Molecular weight: 308.256

Ref: 10-F201701