CAS 890098-95-0

[2-(Acetyloxy)phenyl][3-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(Acetyloxy)phenyl][3-(trifluoromethyl)phenyl]methanone, with the CAS number 890098-95-0, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a trifluoromethyl group attached to phenyl rings. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity under certain conditions. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the acetyloxy group may contribute to the compound's reactivity, particularly in esterification and substitution reactions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can play a critical role in modulating activity and solubility. Overall, this substance represents a unique combination of functional groups that may impart specific chemical and physical properties relevant to various fields of research and application.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1S/C16H11F3O3/c1-10(20)22-14-8-3-2-7-13(14)15(21)11-5-4-6-12(9-11)16(17,18)19/h2-9H,1H3

InChI key: InChIKey=GJCCXWDYFZJOCS-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• [2-(Acetyloxy)phenyl][3-(trifluoromethyl)phenyl]methanone
• 2-[3-(Trifluoromethyl)benzoyl]phenyl acetate
• Methanone, [2-(acetyloxy)phenyl][3-(trifluoromethyl)phenyl]-

2-Acetoxy-3′-trifluorobenzophenone

CAS: 890098-95-0

Formula: C₁₆H₁₁F₃O₃

Purity: 90.0%

Molecular weight: 308.256

Ref: 10-F201702