CAS 890098-97-2

[2-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone, with the CAS number 890098-97-2, is an organic compound characterized by its complex structure, which includes both acetyloxy and trifluoromethyl functional groups. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the acetyloxy group can participate in various chemical reactions, such as esterification or hydrolysis. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the specific environment and conditions. Its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with any chemical substance, proper safety measures should be observed when handling it, considering potential hazards associated with its components.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1S/C16H11F3O3/c1-10(20)22-14-5-3-2-4-13(14)15(21)11-6-8-12(9-7-11)16(17,18)19/h2-9H,1H3

InChI key: InChIKey=RSGWXZBUKINPEM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl][4-(trifluoromethyl)phenyl]-
• 2-[4-(Trifluoromethyl)benzoyl]phenyl acetate
• [2-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone

2-Acetoxy-4′-trifluorobenzophenone

CAS: 890098-97-2

Formula: C₁₆H₁₁F₃O₃

Purity: 90.0%

Molecular weight: 308.256

Ref: 10-F201703