CAS 890098-98-3

Methanone, [2-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-, also known by its CAS number 890098-98-3, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features an acetyloxy group attached to a phenyl ring, which enhances its reactivity and solubility in organic solvents. The presence of methoxy groups at the 3 and 5 positions of the second phenyl ring contributes to its electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. Methanone derivatives often exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its stability, solubility, and reactivity can be influenced by the substituents on the aromatic rings, which can affect its applications in research and industry. Overall, this compound represents a class of methanones that may have significant implications in synthetic organic chemistry and drug development.

Formula: C₁₇H₁₆O₅

InChI: InChI=1S/C17H16O5/c1-11(18)22-16-7-5-4-6-15(16)17(19)12-8-13(20-2)10-14(9-12)21-3/h4-10H,1-3H3

InChI key: InChIKey=CJFMODMURUVMTE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC(OC)=C1)C2=C(OC(C)=O)C=CC=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-
• 2-(3,5-Dimethoxybenzoyl)phenyl acetate

2-Acetoxy-3′,5′-methoxybenzophenone

CAS: 890098-98-3

Formula: C₁₇H₁₆O₅

Purity: 90.0%

Molecular weight: 300.31

Ref: 10-F201754