CAS 890098-99-4
:[2-(2-fluorobenzoyl)phenyl] acetate
Description:
[2-(2-Fluorobenzoyl)phenyl] acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with a 2-fluorobenzoyl group and an acetate moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and relatively low solubility in water due to its hydrophobic nature. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its reactivity and stability. The compound may also display interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in various fields, including materials science and medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks or environmental hazards. Overall, [2-(2-fluorobenzoyl)phenyl] acetate represents a unique chemical entity with specific characteristics that can be leveraged in various applications.
Formula:C15H11FO3
InChI:InChI=1/C15H11FO3/c1-10(17)19-14-9-5-3-7-12(14)15(18)11-6-2-4-8-13(11)16/h2-9H,1H3
SMILES:CC(=O)Oc1ccccc1C(=O)c1ccccc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
